C8H15N3O — CID 83529434
1-(4-aminopyrazol-1-yl)-3-methylbutan-2-ol (PubChem CID 83529434) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is 1-(4-aminopyrazol-1-yl)-3-methylbutan-2-ol.
| Compound Name | 1-(4-aminopyrazol-1-yl)-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 83529434 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 1-(4-aminopyrazol-1-yl)-3-methylbutan-2-ol |
| SMILES | CC(C)C(O)Cn1cc(N)cn1 |
| InChI | InChI=1S/C8H15N3O/c1-6(2)8(12)5-11-4-7(9)3-10-11/h3-4,6,8,12H,5,9H2,1-2H3 |
| InChIKey | JIQZLTBHYJHSSO-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |