C8H13N3O3 — CID 163467197
ethyl (2R)-3-(4-aminopyrazol-1-yl)-2-hydroxypropanoate (PubChem CID 163467197) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is ethyl (2R)-3-(4-aminopyrazol-1-yl)-2-hydroxypropanoate.
| Compound Name | ethyl (2R)-3-(4-aminopyrazol-1-yl)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 163467197 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | ethyl (2R)-3-(4-aminopyrazol-1-yl)-2-hydroxypropanoate |
| SMILES | CCOC(=O)[C@H](O)Cn1cc(N)cn1 |
| InChI | InChI=1S/C8H13N3O3/c1-2-14-8(13)7(12)5-11-4-6(9)3-10-11/h3-4,7,12H,2,5,9H2,1H3/t7-/m1/s1 |
| InChIKey | BTPAVFCCOYZVHM-SSDOTTSWSA-N |
| XLogP | -0.61 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |