C9H15N3O3 — CID 165472981
ethyl 3-(4-amino-3-methylpyrazol-1-yl)-2-hydroxypropanoate (PubChem CID 165472981) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is ethyl 3-(4-amino-3-methylpyrazol-1-yl)-2-hydroxypropanoate.
| Compound Name | ethyl 3-(4-amino-3-methylpyrazol-1-yl)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 165472981 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | ethyl 3-(4-amino-3-methylpyrazol-1-yl)-2-hydroxypropanoate |
| SMILES | CCOC(=O)C(O)Cn1cc(N)c(C)n1 |
| InChI | InChI=1S/C9H15N3O3/c1-3-15-9(14)8(13)5-12-4-7(10)6(2)11-12/h4,8,13H,3,5,10H2,1-2H3 |
| InChIKey | LBWLTFFIOVAPJI-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |