About 1-(4,4,4-trifluoro-2-methylbutyl)pyrazol-4-amine
1-(4,4,4-trifluoro-2-methylbutyl)pyrazol-4-amine (PubChem CID 165479766) has the molecular formula C8H12F3N3
and a molecular weight of 207.20 g/mol. Its IUPAC name is 1-(4,4,4-trifluoro-2-methylbutyl)pyrazol-4-amine.
Molecular Properties
| Compound Name | 1-(4,4,4-trifluoro-2-methylbutyl)pyrazol-4-amine |
| PubChem CID | 165479766 |
| Molecular Formula | C8H12F3N3 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 1-(4,4,4-trifluoro-2-methylbutyl)pyrazol-4-amine |
| SMILES | CC(Cn1cc(N)cn1)CC(F)(F)F |
| InChI | InChI=1S/C8H12F3N3/c1-6(2-8(9,10)11)4-14-5-7(12)3-13-14/h3,5-6H,2,4,12H2,1H3 |
| InChIKey | UGVZZCIQVKNHLP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4,4,4-trifluoro-2-methylbutyl)pyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4,4-trifluoro-2-methylbutyl)pyrazol-4-amine?
The IUPAC name of 1-(4,4,4-trifluoro-2-methylbutyl)pyrazol-4-amine (CID 165479766) is 1-(4,4,4-trifluoro-2-methylbutyl)pyrazol-4-amine.
What is the SMILES notation for 1-(4,4,4-trifluoro-2-methylbutyl)pyrazol-4-amine?
The canonical SMILES for 1-(4,4,4-trifluoro-2-methylbutyl)pyrazol-4-amine is CC(Cn1cc(N)cn1)CC(F)(F)F.
What is the InChIKey of 1-(4,4,4-trifluoro-2-methylbutyl)pyrazol-4-amine?
The InChIKey is UGVZZCIQVKNHLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F3N3/c1-6(2-8(9,10)11)4-14-5-7(12)3-13-14/h3,5-6H,2,4,12H2,1H3.
What are the key properties of 1-(4,4,4-trifluoro-2-methylbutyl)pyrazol-4-amine?
1-(4,4,4-trifluoro-2-methylbutyl)pyrazol-4-amine has a molecular weight of 207.20 g/mol, XLogP of 2.05, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4,4-trifluoro-2-methylbutyl)pyrazol-4-amine is sourced from PubChem (CID 165479766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).