C24H31NO4 — CID 134520082
[4-tert-butyl-2-(ethoxycarbonylamino)-6-methylphenyl] 4-propylbenzoate (PubChem CID 134520082) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is [4-tert-butyl-2-(ethoxycarbonylamino)-6-methylphenyl] 4-propylbenzoate.
| Compound Name | [4-tert-butyl-2-(ethoxycarbonylamino)-6-methylphenyl] 4-propylbenzoate |
|---|---|
| PubChem CID | 134520082 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | [4-tert-butyl-2-(ethoxycarbonylamino)-6-methylphenyl] 4-propylbenzoate |
| SMILES | CCCc1ccc(C(=O)Oc2c(C)cc(C(C)(C)C)cc2NC(=O)OCC)cc1 |
| InChI | InChI=1S/C24H31NO4/c1-7-9-17-10-12-18(13-11-17)22(26)29-21-16(3)14-19(24(4,5)6)15-20(21)25-23(27)28-8-2/h10-15H,7-9H2,1-6H3,(H,25,27) |
| InChIKey | GPIZHAYIMIAJTC-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|