C28H38O4 — CID 90015479
[4-tert-butyl-2-(4-ethoxy-3-methyl-4-oxobutan-2-yl)-6-methylphenyl] 4-propylbenzoate (PubChem CID 90015479) has the molecular formula C28H38O4 and a molecular weight of 438.61 g/mol. Its IUPAC name is [4-tert-butyl-2-(4-ethoxy-3-methyl-4-oxobutan-2-yl)-6-methylphenyl] 4-propylbenzoate.
| Compound Name | [4-tert-butyl-2-(4-ethoxy-3-methyl-4-oxobutan-2-yl)-6-methylphenyl] 4-propylbenzoate |
|---|---|
| PubChem CID | 90015479 |
| Molecular Formula | C28H38O4 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | [4-tert-butyl-2-(4-ethoxy-3-methyl-4-oxobutan-2-yl)-6-methylphenyl] 4-propylbenzoate |
| SMILES | CCCc1ccc(C(=O)Oc2c(C)cc(C(C)(C)C)cc2C(C)C(C)C(=O)OCC)cc1 |
| InChI | InChI=1S/C28H38O4/c1-9-11-21-12-14-22(15-13-21)27(30)32-25-18(3)16-23(28(6,7)8)17-24(25)19(4)20(5)26(29)31-10-2/h12-17,19-20H,9-11H2,1-8H3 |
| InChIKey | XZQMOYMZFXQDQT-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|