C26H33ClO4 — CID 140733860
[4-tert-butyl-2-(1-ethoxy-1-oxohexan-2-yl)-6-methylphenyl] 3-chlorobenzoate (PubChem CID 140733860) has the molecular formula C26H33ClO4 and a molecular weight of 445.00 g/mol. Its IUPAC name is [4-tert-butyl-2-(1-ethoxy-1-oxohexan-2-yl)-6-methylphenyl] 3-chlorobenzoate.
| Compound Name | [4-tert-butyl-2-(1-ethoxy-1-oxohexan-2-yl)-6-methylphenyl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 140733860 |
| Molecular Formula | C26H33ClO4 |
| Molecular Weight | 445.00 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | [4-tert-butyl-2-(1-ethoxy-1-oxohexan-2-yl)-6-methylphenyl] 3-chlorobenzoate |
| SMILES | CCCCC(C(=O)OCC)c1cc(C(C)(C)C)cc(C)c1OC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C26H33ClO4/c1-7-9-13-21(25(29)30-8-2)22-16-19(26(4,5)6)14-17(3)23(22)31-24(28)18-11-10-12-20(27)15-18/h10-12,14-16,21H,7-9,13H2,1-6H3 |
| InChIKey | ISYQURBCVCRALD-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.00 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|