C22H25ClO3 — CID 22261940
ethyl 2-[(3-tert-butylphenyl)methyl]-3-(3-chlorophenyl)-3-oxopropanoate (PubChem CID 22261940) has the molecular formula C22H25ClO3 and a molecular weight of 372.89 g/mol. Its IUPAC name is ethyl 2-[(3-tert-butylphenyl)methyl]-3-(3-chlorophenyl)-3-oxopropanoate.
| Compound Name | ethyl 2-[(3-tert-butylphenyl)methyl]-3-(3-chlorophenyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 22261940 |
| Molecular Formula | C22H25ClO3 |
| Molecular Weight | 372.89 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | ethyl 2-[(3-tert-butylphenyl)methyl]-3-(3-chlorophenyl)-3-oxopropanoate |
| SMILES | CCOC(=O)C(Cc1cccc(C(C)(C)C)c1)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H25ClO3/c1-5-26-21(25)19(20(24)16-9-7-11-18(23)14-16)13-15-8-6-10-17(12-15)22(2,3)4/h6-12,14,19H,5,13H2,1-4H3 |
| InChIKey | MEXBEDYVKAOVIM-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.89 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|