C22H27ClO3 — CID 86593310
ethyl 2-[(3-tert-butylphenyl)methyl]-3-(3-chlorophenyl)-3-hydroxypropanoate (PubChem CID 86593310) has the molecular formula C22H27ClO3 and a molecular weight of 374.91 g/mol. Its IUPAC name is ethyl 2-[(3-tert-butylphenyl)methyl]-3-(3-chlorophenyl)-3-hydroxypropanoate.
| Compound Name | ethyl 2-[(3-tert-butylphenyl)methyl]-3-(3-chlorophenyl)-3-hydroxypropanoate |
|---|---|
| PubChem CID | 86593310 |
| Molecular Formula | C22H27ClO3 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | ethyl 2-[(3-tert-butylphenyl)methyl]-3-(3-chlorophenyl)-3-hydroxypropanoate |
| SMILES | CCOC(=O)C(Cc1cccc(C(C)(C)C)c1)C(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H27ClO3/c1-5-26-21(25)19(20(24)16-9-7-11-18(23)14-16)13-15-8-6-10-17(12-15)22(2,3)4/h6-12,14,19-20,24H,5,13H2,1-4H3 |
| InChIKey | FUZZVGDCUXGLLY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |