C29H40O4 — CID 140733902
[2,4-ditert-butyl-6-(1-ethoxy-1-oxohexan-2-yl)phenyl] benzoate (PubChem CID 140733902) has the molecular formula C29H40O4 and a molecular weight of 452.64 g/mol. Its IUPAC name is [2,4-ditert-butyl-6-(1-ethoxy-1-oxohexan-2-yl)phenyl] benzoate.
| Compound Name | [2,4-ditert-butyl-6-(1-ethoxy-1-oxohexan-2-yl)phenyl] benzoate |
|---|---|
| PubChem CID | 140733902 |
| Molecular Formula | C29H40O4 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | [2,4-ditert-butyl-6-(1-ethoxy-1-oxohexan-2-yl)phenyl] benzoate |
| SMILES | CCCCC(C(=O)OCC)c1cc(C(C)(C)C)cc(C(C)(C)C)c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H40O4/c1-9-11-17-22(27(31)32-10-2)23-18-21(28(3,4)5)19-24(29(6,7)8)25(23)33-26(30)20-15-13-12-14-16-20/h12-16,18-19,22H,9-11,17H2,1-8H3 |
| InChIKey | JAPPBHUXYVJCIH-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|