C27H35ClO4 — CID 90015310
[2-(5-ethoxy-4-methyl-5-oxopentan-2-yl)-4,6-di(propan-2-yl)phenyl] 3-chlorobenzoate (PubChem CID 90015310) has the molecular formula C27H35ClO4 and a molecular weight of 459.03 g/mol. Its IUPAC name is [2-(5-ethoxy-4-methyl-5-oxopentan-2-yl)-4,6-di(propan-2-yl)phenyl] 3-chlorobenzoate.
| Compound Name | [2-(5-ethoxy-4-methyl-5-oxopentan-2-yl)-4,6-di(propan-2-yl)phenyl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 90015310 |
| Molecular Formula | C27H35ClO4 |
| Molecular Weight | 459.03 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | [2-(5-ethoxy-4-methyl-5-oxopentan-2-yl)-4,6-di(propan-2-yl)phenyl] 3-chlorobenzoate |
| SMILES | CCOC(=O)C(C)CC(C)c1cc(C(C)C)cc(C(C)C)c1OC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C27H35ClO4/c1-8-31-26(29)19(7)12-18(6)24-15-21(16(2)3)14-23(17(4)5)25(24)32-27(30)20-10-9-11-22(28)13-20/h9-11,13-19H,8,12H2,1-7H3 |
| InChIKey | SCOYYRGOJHGSHF-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.03 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|