C13H19N7O — CID 134520169
2-[[4-(dimethylamino)-2-(prop-2-enylamino)pyrimido[5,4-d]pyrimidin-6-yl]amino]ethanol (PubChem CID 134520169) has the molecular formula C13H19N7O and a molecular weight of 289.34 g/mol. Its IUPAC name is 2-[[4-(dimethylamino)-2-(prop-2-enylamino)pyrimido[5,4-d]pyrimidin-6-yl]amino]ethanol.
| Compound Name | 2-[[4-(dimethylamino)-2-(prop-2-enylamino)pyrimido[5,4-d]pyrimidin-6-yl]amino]ethanol |
|---|---|
| PubChem CID | 134520169 |
| Molecular Formula | C13H19N7O |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 2-[[4-(dimethylamino)-2-(prop-2-enylamino)pyrimido[5,4-d]pyrimidin-6-yl]amino]ethanol |
| SMILES | C=CCNc1nc(N(C)C)c2nc(NCCO)ncc2n1 |
| InChI | InChI=1S/C13H19N7O/c1-4-5-14-13-17-9-8-16-12(15-6-7-21)18-10(9)11(19-13)20(2)3/h4,8,21H,1,5-7H2,2-3H3,(H,14,17,19)(H,15,16,18) |
| InChIKey | IHUZRSVRSPUNBW-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 99.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|