C19H23N3O2 — CID 134520695
8-[(2S)-2-amino-4-methylpentoxy]-5-methylbenzo[c][1,7]naphthyridin-6-one (PubChem CID 134520695) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 8-[(2S)-2-amino-4-methylpentoxy]-5-methylbenzo[c][1,7]naphthyridin-6-one.
| Compound Name | 8-[(2S)-2-amino-4-methylpentoxy]-5-methylbenzo[c][1,7]naphthyridin-6-one |
|---|---|
| PubChem CID | 134520695 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 8-[(2S)-2-amino-4-methylpentoxy]-5-methylbenzo[c][1,7]naphthyridin-6-one |
| SMILES | CC(C)C[C@H](N)COc1ccc2c(c1)c(=O)n(C)c1cnccc21 |
| InChI | InChI=1S/C19H23N3O2/c1-12(2)8-13(20)11-24-14-4-5-15-16-6-7-21-10-18(16)22(3)19(23)17(15)9-14/h4-7,9-10,12-13H,8,11,20H2,1-3H3/t13-/m0/s1 |
| InChIKey | AFWIYWRRDKQYFS-ZDUSSCGKSA-N |
| XLogP | 2.84 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|