About 8-[(2S)-2-amino-4-methylpentoxy]-5-methylbenzo[c][1,7]naphthyridin-6-one
8-[(2S)-2-amino-4-methylpentoxy]-5-methylbenzo[c][1,7]naphthyridin-6-one (PubChem CID 134520695) has the molecular formula C19H23N3O2
and a molecular weight of 325.41 g/mol. Its IUPAC name is 8-[(2S)-2-amino-4-methylpentoxy]-5-methylbenzo[c][1,7]naphthyridin-6-one.
Molecular Properties
| Compound Name | 8-[(2S)-2-amino-4-methylpentoxy]-5-methylbenzo[c][1,7]naphthyridin-6-one |
| PubChem CID | 134520695 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 8-[(2S)-2-amino-4-methylpentoxy]-5-methylbenzo[c][1,7]naphthyridin-6-one |
| SMILES | CC(C)C[C@H](N)COc1ccc2c(c1)c(=O)n(C)c1cnccc21 |
| InChI | InChI=1S/C19H23N3O2/c1-12(2)8-13(20)11-24-14-4-5-15-16-6-7-21-10-18(16)22(3)19(23)17(15)9-14/h4-7,9-10,12-13H,8,11,20H2,1-3H3/t13-/m0/s1 |
| InChIKey | AFWIYWRRDKQYFS-ZDUSSCGKSA-N |
| XLogP | 2.84 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 8-[(2S)-2-amino-4-methylpentoxy]-5-methylbenzo[c][1,7]naphthyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(2S)-2-amino-4-methylpentoxy]-5-methylbenzo[c][1,7]naphthyridin-6-one?
The IUPAC name of 8-[(2S)-2-amino-4-methylpentoxy]-5-methylbenzo[c][1,7]naphthyridin-6-one (CID 134520695) is 8-[(2S)-2-amino-4-methylpentoxy]-5-methylbenzo[c][1,7]naphthyridin-6-one.
What is the SMILES notation for 8-[(2S)-2-amino-4-methylpentoxy]-5-methylbenzo[c][1,7]naphthyridin-6-one?
The canonical SMILES for 8-[(2S)-2-amino-4-methylpentoxy]-5-methylbenzo[c][1,7]naphthyridin-6-one is CC(C)C[C@H](N)COc1ccc2c(c1)c(=O)n(C)c1cnccc21.
What is the InChIKey of 8-[(2S)-2-amino-4-methylpentoxy]-5-methylbenzo[c][1,7]naphthyridin-6-one?
The InChIKey is AFWIYWRRDKQYFS-ZDUSSCGKSA-N. The full InChI is InChI=1S/C19H23N3O2/c1-12(2)8-13(20)11-24-14-4-5-15-16-6-7-21-10-18(16)22(3)19(23)17(15)9-14/h4-7,9-10,12-13H,8,11,20H2,1-3H3/t13-/m0/s1.
What are the key properties of 8-[(2S)-2-amino-4-methylpentoxy]-5-methylbenzo[c][1,7]naphthyridin-6-one?
8-[(2S)-2-amino-4-methylpentoxy]-5-methylbenzo[c][1,7]naphthyridin-6-one has a molecular weight of 325.41 g/mol, XLogP of 2.84, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(2S)-2-amino-4-methylpentoxy]-5-methylbenzo[c][1,7]naphthyridin-6-one is sourced from PubChem (CID 134520695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).