C23H19FN4O4S — CID 134522120
N-(1,1-dioxothiolan-3-yl)-1-(4-fluorophenyl)-3-(1-oxidopyridin-1-ium-3-yl)indazole-6-carboxamide (PubChem CID 134522120) has the molecular formula C23H19FN4O4S and a molecular weight of 466.49 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-1-(4-fluorophenyl)-3-(1-oxidopyridin-1-ium-3-yl)indazole-6-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-1-(4-fluorophenyl)-3-(1-oxidopyridin-1-ium-3-yl)indazole-6-carboxamide |
|---|---|
| PubChem CID | 134522120 |
| Molecular Formula | C23H19FN4O4S |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-1-(4-fluorophenyl)-3-(1-oxidopyridin-1-ium-3-yl)indazole-6-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1ccc2c(-c3ccc[n+]([O-])c3)nn(-c3ccc(F)cc3)c2c1 |
| InChI | InChI=1S/C23H19FN4O4S/c24-17-4-6-19(7-5-17)28-21-12-15(23(29)25-18-9-11-33(31,32)14-18)3-8-20(21)22(26-28)16-2-1-10-27(30)13-16/h1-8,10,12-13,18H,9,11,14H2,(H,25,29) |
| InChIKey | MPGRDAHTZGDVKH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|