C25H19FN4O3S — CID 134522149
3-(3-cyanophenyl)-N-(1,1-dioxothiolan-3-yl)-1-(4-fluorophenyl)indazole-6-carboxamide (PubChem CID 134522149) has the molecular formula C25H19FN4O3S and a molecular weight of 474.52 g/mol. Its IUPAC name is 3-(3-cyanophenyl)-N-(1,1-dioxothiolan-3-yl)-1-(4-fluorophenyl)indazole-6-carboxamide.
| Compound Name | 3-(3-cyanophenyl)-N-(1,1-dioxothiolan-3-yl)-1-(4-fluorophenyl)indazole-6-carboxamide |
|---|---|
| PubChem CID | 134522149 |
| Molecular Formula | C25H19FN4O3S |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 3-(3-cyanophenyl)-N-(1,1-dioxothiolan-3-yl)-1-(4-fluorophenyl)indazole-6-carboxamide |
| SMILES | N#Cc1cccc(-c2nn(-c3ccc(F)cc3)c3cc(C(=O)NC4CCS(=O)(=O)C4)ccc23)c1 |
| InChI | InChI=1S/C25H19FN4O3S/c26-19-5-7-21(8-6-19)30-23-13-18(25(31)28-20-10-11-34(32,33)15-20)4-9-22(23)24(29-30)17-3-1-2-16(12-17)14-27/h1-9,12-13,20H,10-11,15H2,(H,28,31) |
| InChIKey | OORHHHPGRNGJJR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 104.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |