C24H16ClFN4O — CID 134522594
3-(2-chlorophenyl)-N-(1-cyanocyclopropyl)-1-(4-fluorophenyl)indazole-6-carboxamide (PubChem CID 134522594) has the molecular formula C24H16ClFN4O and a molecular weight of 430.87 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-(1-cyanocyclopropyl)-1-(4-fluorophenyl)indazole-6-carboxamide.
| Compound Name | 3-(2-chlorophenyl)-N-(1-cyanocyclopropyl)-1-(4-fluorophenyl)indazole-6-carboxamide |
|---|---|
| PubChem CID | 134522594 |
| Molecular Formula | C24H16ClFN4O |
| Molecular Weight | 430.87 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 3-(2-chlorophenyl)-N-(1-cyanocyclopropyl)-1-(4-fluorophenyl)indazole-6-carboxamide |
| SMILES | N#CC1(NC(=O)c2ccc3c(-c4ccccc4Cl)nn(-c4ccc(F)cc4)c3c2)CC1 |
| InChI | InChI=1S/C24H16ClFN4O/c25-20-4-2-1-3-18(20)22-19-10-5-15(23(31)28-24(14-27)11-12-24)13-21(19)30(29-22)17-8-6-16(26)7-9-17/h1-10,13H,11-12H2,(H,28,31) |
| InChIKey | YDTWYYDEMILEQX-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.87 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |