C21H14ClFN2O2 — CID 153447161
1-[3-(2-chlorophenyl)-1-(4-fluorophenyl)indazol-6-yl]-2-hydroxyethanone (PubChem CID 153447161) has the molecular formula C21H14ClFN2O2 and a molecular weight of 380.81 g/mol. Its IUPAC name is 1-[3-(2-chlorophenyl)-1-(4-fluorophenyl)indazol-6-yl]-2-hydroxyethanone.
| Compound Name | 1-[3-(2-chlorophenyl)-1-(4-fluorophenyl)indazol-6-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 153447161 |
| Molecular Formula | C21H14ClFN2O2 |
| Molecular Weight | 380.81 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 1-[3-(2-chlorophenyl)-1-(4-fluorophenyl)indazol-6-yl]-2-hydroxyethanone |
| SMILES | O=C(CO)c1ccc2c(-c3ccccc3Cl)nn(-c3ccc(F)cc3)c2c1 |
| InChI | InChI=1S/C21H14ClFN2O2/c22-18-4-2-1-3-16(18)21-17-10-5-13(20(27)12-26)11-19(17)25(24-21)15-8-6-14(23)7-9-15/h1-11,26H,12H2 |
| InChIKey | KISISBCQTGBMGJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.81 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |