C13H23N — CID 134527332
2-methyl-1-(1-methyl-3-propylcyclopent-3-en-1-yl)prop-2-en-1-amine (PubChem CID 134527332) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 2-methyl-1-(1-methyl-3-propylcyclopent-3-en-1-yl)prop-2-en-1-amine.
| Compound Name | 2-methyl-1-(1-methyl-3-propylcyclopent-3-en-1-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 134527332 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 2-methyl-1-(1-methyl-3-propylcyclopent-3-en-1-yl)prop-2-en-1-amine |
| SMILES | C=C(C)C(N)C1(C)CC=C(CCC)C1 |
| InChI | InChI=1S/C13H23N/c1-5-6-11-7-8-13(4,9-11)12(14)10(2)3/h7,12H,2,5-6,8-9,14H2,1,3-4H3 |
| InChIKey | GADJYPWJGFSBTM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|