C21H25NO4S — CID 134527682
S-[1-[4-[2-(5-ethyl-2-pyridinyl)-2-hydroxyethoxy]phenyl]-3-oxobutan-2-yl] ethanethioate (PubChem CID 134527682) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is S-[1-[4-[2-(5-ethyl-2-pyridinyl)-2-hydroxyethoxy]phenyl]-3-oxobutan-2-yl] ethanethioate.
| Compound Name | S-[1-[4-[2-(5-ethyl-2-pyridinyl)-2-hydroxyethoxy]phenyl]-3-oxobutan-2-yl] ethanethioate |
|---|---|
| PubChem CID | 134527682 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | S-[1-[4-[2-(5-ethyl-2-pyridinyl)-2-hydroxyethoxy]phenyl]-3-oxobutan-2-yl] ethanethioate |
| SMILES | CCc1ccc(C(O)COc2ccc(CC(SC(C)=O)C(C)=O)cc2)nc1 |
| InChI | InChI=1S/C21H25NO4S/c1-4-16-7-10-19(22-12-16)20(25)13-26-18-8-5-17(6-9-18)11-21(14(2)23)27-15(3)24/h5-10,12,20-21,25H,4,11,13H2,1-3H3 |
| InChIKey | QUZWNEGZMDUZKU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|