C21H24BrNO5 — CID 14546507
methyl 3-[4-[2-acetyloxy-2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]-2-bromopropanoate (PubChem CID 14546507) has the molecular formula C21H24BrNO5 and a molecular weight of 450.33 g/mol. Its IUPAC name is methyl 3-[4-[2-acetyloxy-2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]-2-bromopropanoate.
| Compound Name | methyl 3-[4-[2-acetyloxy-2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]-2-bromopropanoate |
|---|---|
| PubChem CID | 14546507 |
| Molecular Formula | C21H24BrNO5 |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | methyl 3-[4-[2-acetyloxy-2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]-2-bromopropanoate |
| SMILES | CCc1ccc(C(COc2ccc(CC(Br)C(=O)OC)cc2)OC(C)=O)nc1 |
| InChI | InChI=1S/C21H24BrNO5/c1-4-15-7-10-19(23-12-15)20(28-14(2)24)13-27-17-8-5-16(6-9-17)11-18(22)21(25)26-3/h5-10,12,18,20H,4,11,13H2,1-3H3 |
| InChIKey | ORUTUVMPXPLQPC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|