C9H9F9O2 — CID 134531027
3,3,4-trifluoro-4-(1,1,2,2,3,3-hexafluoro-3-methoxypropoxy)-2-methylbut-1-ene (PubChem CID 134531027) has the molecular formula C9H9F9O2 and a molecular weight of 320.15 g/mol. Its IUPAC name is 3,3,4-trifluoro-4-(1,1,2,2,3,3-hexafluoro-3-methoxypropoxy)-2-methylbut-1-ene.
| Compound Name | 3,3,4-trifluoro-4-(1,1,2,2,3,3-hexafluoro-3-methoxypropoxy)-2-methylbut-1-ene |
|---|---|
| PubChem CID | 134531027 |
| Molecular Formula | C9H9F9O2 |
| Molecular Weight | 320.15 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 3,3,4-trifluoro-4-(1,1,2,2,3,3-hexafluoro-3-methoxypropoxy)-2-methylbut-1-ene |
| SMILES | C=C(C)C(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)OC |
| InChI | InChI=1S/C9H9F9O2/c1-4(2)6(11,12)5(10)20-9(17,18)7(13,14)8(15,16)19-3/h5H,1H2,2-3H3 |
| InChIKey | HMGDRTRFHRSJDZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.15 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|