C17H18N4O5S — CID 134531815
(2S)-2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxopropylidene]amino]oxy-3-(4-ethanimidoylphenoxy)propanoic acid (PubChem CID 134531815) has the molecular formula C17H18N4O5S and a molecular weight of 390.42 g/mol. Its IUPAC name is (2S)-2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxopropylidene]amino]oxy-3-(4-ethanimidoylphenoxy)propanoic acid.
| Compound Name | (2S)-2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxopropylidene]amino]oxy-3-(4-ethanimidoylphenoxy)propanoic acid |
|---|---|
| PubChem CID | 134531815 |
| Molecular Formula | C17H18N4O5S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | (2S)-2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxopropylidene]amino]oxy-3-(4-ethanimidoylphenoxy)propanoic acid |
| SMILES | [H]/N=C(\C)c1ccc(OC[C@H](O/N=C(\C(C)=O)c2csc(N)n2)C(=O)O)cc1 |
| InChI | InChI=1S/C17H18N4O5S/c1-9(18)11-3-5-12(6-4-11)25-7-14(16(23)24)26-21-15(10(2)22)13-8-27-17(19)20-13/h3-6,8,14,18H,7H2,1-2H3,(H2,19,20)(H,23,24)/b18-9+,21-15+/t14-/m0/s1 |
| InChIKey | KUXMMQMEDNXJQT-PNKQHAHHSA-N |
| XLogP | 1.95 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|