C20H26ClN7O4S — CID 134535215
1-[(1R,2S)-1-(5-chloropyrimidin-2-yl)-1-methoxypropan-2-yl]sulfonyl-2-cyclobutyl-3-[(5-methylpyridine-3-carbonyl)amino]guanidine (PubChem CID 134535215) has the molecular formula C20H26ClN7O4S and a molecular weight of 495.99 g/mol. Its IUPAC name is 1-[(1R,2S)-1-(5-chloropyrimidin-2-yl)-1-methoxypropan-2-yl]sulfonyl-2-cyclobutyl-3-[(5-methylpyridine-3-carbonyl)amino]guanidine.
| Compound Name | 1-[(1R,2S)-1-(5-chloropyrimidin-2-yl)-1-methoxypropan-2-yl]sulfonyl-2-cyclobutyl-3-[(5-methylpyridine-3-carbonyl)amino]guanidine |
|---|---|
| PubChem CID | 134535215 |
| Molecular Formula | C20H26ClN7O4S |
| Molecular Weight | 495.99 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 1-[(1R,2S)-1-(5-chloropyrimidin-2-yl)-1-methoxypropan-2-yl]sulfonyl-2-cyclobutyl-3-[(5-methylpyridine-3-carbonyl)amino]guanidine |
| SMILES | CO[C@H](c1ncc(Cl)cn1)[C@H](C)S(=O)(=O)N/C(=N/C1CCC1)NNC(=O)c1cncc(C)c1 |
| InChI | InChI=1S/C20H26ClN7O4S/c1-12-7-14(9-22-8-12)19(29)26-27-20(25-16-5-4-6-16)28-33(30,31)13(2)17(32-3)18-23-10-15(21)11-24-18/h7-11,13,16-17H,4-6H2,1-3H3,(H,26,29)(H2,25,27,28)/t13-,17-/m0/s1 |
| InChIKey | FWYMPGRLELNRBX-GUYCJALGSA-N |
| XLogP | 1.67 |
| TPSA | 147.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.99 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|