C23H28ClN7O5S — CID 139548469
1-[(1R,2S)-1-(5-chloropyrimidin-2-yl)-1-methoxypropan-2-yl]sulfonyl-2-dispiro[2.0.24.13]heptan-7-yl-3-[(6-methoxypyridine-2-carbonyl)amino]guanidine (PubChem CID 139548469) has the molecular formula C23H28ClN7O5S and a molecular weight of 550.04 g/mol. Its IUPAC name is 1-[(1R,2S)-1-(5-chloropyrimidin-2-yl)-1-methoxypropan-2-yl]sulfonyl-2-dispiro[2.0.24.13]heptan-7-yl-3-[(6-methoxypyridine-2-carbonyl)amino]guanidine.
| Compound Name | 1-[(1R,2S)-1-(5-chloropyrimidin-2-yl)-1-methoxypropan-2-yl]sulfonyl-2-dispiro[2.0.24.13]heptan-7-yl-3-[(6-methoxypyridine-2-carbonyl)amino]guanidine |
|---|---|
| PubChem CID | 139548469 |
| Molecular Formula | C23H28ClN7O5S |
| Molecular Weight | 550.04 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | 1-[(1R,2S)-1-(5-chloropyrimidin-2-yl)-1-methoxypropan-2-yl]sulfonyl-2-dispiro[2.0.24.13]heptan-7-yl-3-[(6-methoxypyridine-2-carbonyl)amino]guanidine |
| SMILES | COc1cccc(C(=O)NN/C(=N\C2C3(CC3)C23CC3)NS(=O)(=O)[C@@H](C)[C@H](OC)c2ncc(Cl)cn2)n1 |
| InChI | InChI=1S/C23H28ClN7O5S/c1-13(17(36-3)18-25-11-14(24)12-26-18)37(33,34)31-21(28-20-22(7-8-22)23(20)9-10-23)30-29-19(32)15-5-4-6-16(27-15)35-2/h4-6,11-13,17,20H,7-10H2,1-3H3,(H,29,32)(H2,28,30,31)/t13-,17-/m0/s1 |
| InChIKey | VNTAGBRGSIXTSA-GUYCJALGSA-N |
| XLogP | 1.76 |
| TPSA | 156.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.04 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|