C25H31N7O7S — CID 122701686
1-(2,6-dimethoxyphenyl)-2-[(1S,2R)-1-methoxy-1-(5-methylpyrimidin-2-yl)propan-2-yl]sulfonyl-3-[(6-methoxypyridine-2-carbonyl)amino]guanidine (PubChem CID 122701686) has the molecular formula C25H31N7O7S and a molecular weight of 573.63 g/mol. Its IUPAC name is 1-(2,6-dimethoxyphenyl)-2-[(1S,2R)-1-methoxy-1-(5-methylpyrimidin-2-yl)propan-2-yl]sulfonyl-3-[(6-methoxypyridine-2-carbonyl)amino]guanidine.
| Compound Name | 1-(2,6-dimethoxyphenyl)-2-[(1S,2R)-1-methoxy-1-(5-methylpyrimidin-2-yl)propan-2-yl]sulfonyl-3-[(6-methoxypyridine-2-carbonyl)amino]guanidine |
|---|---|
| PubChem CID | 122701686 |
| Molecular Formula | C25H31N7O7S |
| Molecular Weight | 573.63 g/mol |
| Exact Mass | 573.20 |
| IUPAC Name | 1-(2,6-dimethoxyphenyl)-2-[(1S,2R)-1-methoxy-1-(5-methylpyrimidin-2-yl)propan-2-yl]sulfonyl-3-[(6-methoxypyridine-2-carbonyl)amino]guanidine |
| SMILES | COc1cccc(C(=O)NN/C(=N\S(=O)(=O)[C@H](C)[C@@H](OC)c2ncc(C)cn2)Nc2c(OC)cccc2OC)n1 |
| InChI | InChI=1S/C25H31N7O7S/c1-15-13-26-23(27-14-15)22(39-6)16(2)40(34,35)32-25(29-21-18(36-3)10-8-11-19(21)37-4)31-30-24(33)17-9-7-12-20(28-17)38-5/h7-14,16,22H,1-6H3,(H,30,33)(H2,29,31,32)/t16-,22-/m1/s1 |
| InChIKey | NMGGXPMCASZTLV-OPAMFIHVSA-N |
| XLogP | 2.01 |
| TPSA | 175.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.63 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|