C26H29N7O6S — CID 134542336
1-(1,2-benzoxazole-3-carbonylamino)-3-(2,6-dimethoxyphenyl)-2-[(2S,3R)-3-(5-methylpyrimidin-2-yl)butan-2-yl]sulfonylguanidine (PubChem CID 134542336) has the molecular formula C26H29N7O6S and a molecular weight of 567.63 g/mol. Its IUPAC name is 1-(1,2-benzoxazole-3-carbonylamino)-3-(2,6-dimethoxyphenyl)-2-[(2S,3R)-3-(5-methylpyrimidin-2-yl)butan-2-yl]sulfonylguanidine.
| Compound Name | 1-(1,2-benzoxazole-3-carbonylamino)-3-(2,6-dimethoxyphenyl)-2-[(2S,3R)-3-(5-methylpyrimidin-2-yl)butan-2-yl]sulfonylguanidine |
|---|---|
| PubChem CID | 134542336 |
| Molecular Formula | C26H29N7O6S |
| Molecular Weight | 567.63 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | 1-(1,2-benzoxazole-3-carbonylamino)-3-(2,6-dimethoxyphenyl)-2-[(2S,3R)-3-(5-methylpyrimidin-2-yl)butan-2-yl]sulfonylguanidine |
| SMILES | COc1cccc(OC)c1N/C(=N/S(=O)(=O)[C@@H](C)[C@H](C)c1ncc(C)cn1)NNC(=O)c1noc2ccccc12 |
| InChI | InChI=1S/C26H29N7O6S/c1-15-13-27-24(28-14-15)16(2)17(3)40(35,36)33-26(29-23-20(37-4)11-8-12-21(23)38-5)31-30-25(34)22-18-9-6-7-10-19(18)39-32-22/h6-14,16-17H,1-5H3,(H,30,34)(H2,29,31,33)/t16-,17-/m0/s1 |
| InChIKey | QSVQUCZGAPNQIM-IRXDYDNUSA-N |
| XLogP | 3.17 |
| TPSA | 169.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.63 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|