C23H32N6O6S — CID 160889713
1-(2,6-dimethoxyphenyl)-2-[(2S,3R)-3-(5-methylpyrimidin-2-yl)butan-2-yl]sulfonyl-3-[[(3R)-oxolane-3-carbonyl]amino]guanidine (PubChem CID 160889713) has the molecular formula C23H32N6O6S and a molecular weight of 520.61 g/mol. Its IUPAC name is 1-(2,6-dimethoxyphenyl)-2-[(2S,3R)-3-(5-methylpyrimidin-2-yl)butan-2-yl]sulfonyl-3-[[(3R)-oxolane-3-carbonyl]amino]guanidine.
| Compound Name | 1-(2,6-dimethoxyphenyl)-2-[(2S,3R)-3-(5-methylpyrimidin-2-yl)butan-2-yl]sulfonyl-3-[[(3R)-oxolane-3-carbonyl]amino]guanidine |
|---|---|
| PubChem CID | 160889713 |
| Molecular Formula | C23H32N6O6S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | 1-(2,6-dimethoxyphenyl)-2-[(2S,3R)-3-(5-methylpyrimidin-2-yl)butan-2-yl]sulfonyl-3-[[(3R)-oxolane-3-carbonyl]amino]guanidine |
| SMILES | COc1cccc(OC)c1NC(=NS(=O)(=O)[C@@H](C)[C@H](C)c1ncc(C)cn1)NNC(=O)[C@@H]1CCOC1 |
| InChI | InChI=1S/C23H32N6O6S/c1-14-11-24-21(25-12-14)15(2)16(3)36(31,32)29-23(28-27-22(30)17-9-10-35-13-17)26-20-18(33-4)7-6-8-19(20)34-5/h6-8,11-12,15-17H,9-10,13H2,1-5H3,(H,27,30)(H2,26,28,29)/t15-,16-,17+/m0/s1 |
| InChIKey | WGKKAEVUMSPRSP-YESZJQIVSA-N |
| XLogP | 1.75 |
| TPSA | 153.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|