C26H34N8O5S — CID 172983618
1-(2,6-dimethoxyphenyl)-3-[(E)-1-(6-methoxy-2-pyridinyl)ethylideneamino]-2-[(1S,2R)-1-(methylamino)-1-(5-methylpyrimidin-2-yl)propan-2-yl]sulfonylguanidine (PubChem CID 172983618) has the molecular formula C26H34N8O5S and a molecular weight of 570.68 g/mol. Its IUPAC name is 1-(2,6-dimethoxyphenyl)-3-[(E)-1-(6-methoxy-2-pyridinyl)ethylideneamino]-2-[(1S,2R)-1-(methylamino)-1-(5-methylpyrimidin-2-yl)propan-2-yl]sulfonylguanidine.
| Compound Name | 1-(2,6-dimethoxyphenyl)-3-[(E)-1-(6-methoxy-2-pyridinyl)ethylideneamino]-2-[(1S,2R)-1-(methylamino)-1-(5-methylpyrimidin-2-yl)propan-2-yl]sulfonylguanidine |
|---|---|
| PubChem CID | 172983618 |
| Molecular Formula | C26H34N8O5S |
| Molecular Weight | 570.68 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | 1-(2,6-dimethoxyphenyl)-3-[(E)-1-(6-methoxy-2-pyridinyl)ethylideneamino]-2-[(1S,2R)-1-(methylamino)-1-(5-methylpyrimidin-2-yl)propan-2-yl]sulfonylguanidine |
| SMILES | CN[C@@H](c1ncc(C)cn1)[C@@H](C)S(=O)(=O)N=C(N/N=C(\C)c1cccc(OC)n1)Nc1c(OC)cccc1OC |
| InChI | InChI=1S/C26H34N8O5S/c1-16-14-28-25(29-15-16)23(27-4)18(3)40(35,36)34-26(31-24-20(37-5)11-9-12-21(24)38-6)33-32-17(2)19-10-8-13-22(30-19)39-7/h8-15,18,23,27H,1-7H3,(H2,31,33,34)/b32-17+/t18-,23-/m1/s1 |
| InChIKey | MRPGRCKLPLZDTD-YNHNUBNKSA-N |
| XLogP | 2.67 |
| TPSA | 161.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.68 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|