C51H34N5O2P — CID 134536006
5-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-1,2,3-triphenyl-1,3,2λ5-benzodiazaphosphole 2-oxide (PubChem CID 134536006) has the molecular formula C51H34N5O2P and a molecular weight of 779.84 g/mol. Its IUPAC name is 5-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-1,2,3-triphenyl-1,3,2λ5-benzodiazaphosphole 2-oxide.
| Compound Name | 5-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-1,2,3-triphenyl-1,3,2λ5-benzodiazaphosphole 2-oxide |
|---|---|
| PubChem CID | 134536006 |
| Molecular Formula | C51H34N5O2P |
| Molecular Weight | 779.84 g/mol |
| Exact Mass | 779.25 |
| IUPAC Name | 5-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-1,2,3-triphenyl-1,3,2λ5-benzodiazaphosphole 2-oxide |
| SMILES | O=P1(c2ccccc2)N(c2ccccc2)c2ccc(-c3ccc4oc5c(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)cccc5c4c3)cc2N1c1ccccc1 |
| InChI | InChI=1S/C51H34N5O2P/c57-59(41-25-14-5-15-26-41)55(39-21-10-3-11-22-39)45-31-29-38(34-46(45)56(59)40-23-12-4-13-24-40)37-30-32-47-44(33-37)42-27-16-28-43(48(42)58-47)51-53-49(35-17-6-1-7-18-35)52-50(54-51)36-19-8-2-9-20-36/h1-34H |
| InChIKey | CKFFHDRCHYDRAO-UHFFFAOYSA-N |
| XLogP | 13.25 |
| TPSA | 75.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.84 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|