C9H12ClNO5S2 — CID 134541612
(2S)-2-(4-chloro-2-methylsulfonylphenyl)-2-hydroxyethanesulfonamide (PubChem CID 134541612) has the molecular formula C9H12ClNO5S2 and a molecular weight of 313.78 g/mol. Its IUPAC name is (2S)-2-(4-chloro-2-methylsulfonylphenyl)-2-hydroxyethanesulfonamide.
| Compound Name | (2S)-2-(4-chloro-2-methylsulfonylphenyl)-2-hydroxyethanesulfonamide |
|---|---|
| PubChem CID | 134541612 |
| Molecular Formula | C9H12ClNO5S2 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 312.98 |
| IUPAC Name | (2S)-2-(4-chloro-2-methylsulfonylphenyl)-2-hydroxyethanesulfonamide |
| SMILES | CS(=O)(=O)c1cc(Cl)ccc1[C@H](O)CS(N)(=O)=O |
| InChI | InChI=1S/C9H12ClNO5S2/c1-17(13,14)9-4-6(10)2-3-7(9)8(12)5-18(11,15)16/h2-4,8,12H,5H2,1H3,(H2,11,15,16)/t8-/m1/s1 |
| InChIKey | LZOAIGLBUNMALH-MRVPVSSYSA-N |
| XLogP | 0.07 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |