C14H18N4O2S — CID 134542057
N-amino-N'-(2,6-dimethoxyphenyl)-4-ethyl-1,3-thiazole-2-carboximidamide (PubChem CID 134542057) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is N-amino-N'-(2,6-dimethoxyphenyl)-4-ethyl-1,3-thiazole-2-carboximidamide.
| Compound Name | N-amino-N'-(2,6-dimethoxyphenyl)-4-ethyl-1,3-thiazole-2-carboximidamide |
|---|---|
| PubChem CID | 134542057 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-amino-N'-(2,6-dimethoxyphenyl)-4-ethyl-1,3-thiazole-2-carboximidamide |
| SMILES | CCc1csc(/C(=N/c2c(OC)cccc2OC)NN)n1 |
| InChI | InChI=1S/C14H18N4O2S/c1-4-9-8-21-14(16-9)13(18-15)17-12-10(19-2)6-5-7-11(12)20-3/h5-8H,4,15H2,1-3H3,(H,17,18) |
| InChIKey | HPERPTOYVAAHCD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|