C21H26N2O4 — CID 102407656
2-N,4-N-bis(2,6-dimethoxyphenyl)pentane-2,4-diimine (PubChem CID 102407656) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-N,4-N-bis(2,6-dimethoxyphenyl)pentane-2,4-diimine.
| Compound Name | 2-N,4-N-bis(2,6-dimethoxyphenyl)pentane-2,4-diimine |
|---|---|
| PubChem CID | 102407656 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2-N,4-N-bis(2,6-dimethoxyphenyl)pentane-2,4-diimine |
| SMILES | COc1cccc(OC)c1/N=C(\C)C/C(C)=N/c1c(OC)cccc1OC |
| InChI | InChI=1S/C21H26N2O4/c1-14(22-20-16(24-3)9-7-10-17(20)25-4)13-15(2)23-21-18(26-5)11-8-12-19(21)27-6/h7-12H,13H2,1-6H3/b22-14+,23-15+ |
| InChIKey | KEXAESOEVINUFO-HOFJZWJUSA-N |
| XLogP | 5.00 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|