C10H14F2N4 — CID 134542946
N-[(3,3-difluoropiperidin-4-yl)methyl]pyrimidin-4-amine (PubChem CID 134542946) has the molecular formula C10H14F2N4 and a molecular weight of 228.25 g/mol. Its IUPAC name is N-[(3,3-difluoropiperidin-4-yl)methyl]pyrimidin-4-amine.
| Compound Name | N-[(3,3-difluoropiperidin-4-yl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 134542946 |
| Molecular Formula | C10H14F2N4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | N-[(3,3-difluoropiperidin-4-yl)methyl]pyrimidin-4-amine |
| SMILES | FC1(F)CNCCC1CNc1ccncn1 |
| InChI | InChI=1S/C10H14F2N4/c11-10(12)6-13-3-1-8(10)5-15-9-2-4-14-7-16-9/h2,4,7-8,13H,1,3,5-6H2,(H,14,15,16) |
| InChIKey | VEOWYYZAVWAIJV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |