C14H26N2 — CID 134547515
(Z)-4-N,5,5-trimethyl-4-N-[(2E)-penta-2,4-dien-2-yl]hex-3-ene-2,4-diamine (PubChem CID 134547515) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is (Z)-4-N,5,5-trimethyl-4-N-[(2E)-penta-2,4-dien-2-yl]hex-3-ene-2,4-diamine.
| Compound Name | (Z)-4-N,5,5-trimethyl-4-N-[(2E)-penta-2,4-dien-2-yl]hex-3-ene-2,4-diamine |
|---|---|
| PubChem CID | 134547515 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | (Z)-4-N,5,5-trimethyl-4-N-[(2E)-penta-2,4-dien-2-yl]hex-3-ene-2,4-diamine |
| SMILES | C=C/C=C(\C)N(C)/C(=C\C(C)N)C(C)(C)C |
| InChI | InChI=1S/C14H26N2/c1-8-9-12(3)16(7)13(10-11(2)15)14(4,5)6/h8-11H,1,15H2,2-7H3/b12-9+,13-10- |
| InChIKey | UJLOYSRJUGHWJA-FMYPVGJQSA-N |
| XLogP | 3.29 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|