C22H27ClFN3O2S2 — CID 134548359
N-[(5-chloro-2-ethylsulfinylphenyl)methyl]-3-fluoro-4-[[(3R)-3-(methylsulfanylamino)pyrrolidin-1-yl]methyl]benzamide (PubChem CID 134548359) has the molecular formula C22H27ClFN3O2S2 and a molecular weight of 484.06 g/mol. Its IUPAC name is N-[(5-chloro-2-ethylsulfinylphenyl)methyl]-3-fluoro-4-[[(3R)-3-(methylsulfanylamino)pyrrolidin-1-yl]methyl]benzamide.
| Compound Name | N-[(5-chloro-2-ethylsulfinylphenyl)methyl]-3-fluoro-4-[[(3R)-3-(methylsulfanylamino)pyrrolidin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 134548359 |
| Molecular Formula | C22H27ClFN3O2S2 |
| Molecular Weight | 484.06 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | N-[(5-chloro-2-ethylsulfinylphenyl)methyl]-3-fluoro-4-[[(3R)-3-(methylsulfanylamino)pyrrolidin-1-yl]methyl]benzamide |
| SMILES | CCS(=O)c1ccc(Cl)cc1CNC(=O)c1ccc(CN2CC[C@@H](NSC)C2)c(F)c1 |
| InChI | InChI=1S/C22H27ClFN3O2S2/c1-3-31(29)21-7-6-18(23)10-17(21)12-25-22(28)15-4-5-16(20(24)11-15)13-27-9-8-19(14-27)26-30-2/h4-7,10-11,19,26H,3,8-9,12-14H2,1-2H3,(H,25,28)/t19-,31?/m1/s1 |
| InChIKey | UDCVOXBYTPLXPQ-MFUYNUFSSA-N |
| XLogP | 3.98 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.06 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|