C23H24Cl2F3IN2O3S — CID 134548534
3-chloro-N-[(5-chloro-2-ethylsulfinylphenyl)methyl]-4-[[(3S)-3-iodopiperidin-1-yl]methyl]-5-(trifluoromethoxy)benzamide (PubChem CID 134548534) has the molecular formula C23H24Cl2F3IN2O3S and a molecular weight of 663.33 g/mol. Its IUPAC name is 3-chloro-N-[(5-chloro-2-ethylsulfinylphenyl)methyl]-4-[[(3S)-3-iodopiperidin-1-yl]methyl]-5-(trifluoromethoxy)benzamide.
| Compound Name | 3-chloro-N-[(5-chloro-2-ethylsulfinylphenyl)methyl]-4-[[(3S)-3-iodopiperidin-1-yl]methyl]-5-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 134548534 |
| Molecular Formula | C23H24Cl2F3IN2O3S |
| Molecular Weight | 663.33 g/mol |
| Exact Mass | 661.99 |
| IUPAC Name | 3-chloro-N-[(5-chloro-2-ethylsulfinylphenyl)methyl]-4-[[(3S)-3-iodopiperidin-1-yl]methyl]-5-(trifluoromethoxy)benzamide |
| SMILES | CCS(=O)c1ccc(Cl)cc1CNC(=O)c1cc(Cl)c(CN2CCC[C@H](I)C2)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C23H24Cl2F3IN2O3S/c1-2-35(33)21-6-5-16(24)8-15(21)11-30-22(32)14-9-19(25)18(20(10-14)34-23(26,27)28)13-31-7-3-4-17(29)12-31/h5-6,8-10,17H,2-4,7,11-13H2,1H3,(H,30,32)/t17-,35?/m0/s1 |
| InChIKey | HXRWEMBNIOIIOV-VCXWBMQSSA-N |
| XLogP | 6.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.33 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|