C24H29ClF3N3O5S — CID 134548576
N-[(5-chloro-2-ethylsulfonylphenyl)methyl]-3-[4-(1-hydroxyethylamino)piperidin-1-yl]-5-(trifluoromethoxy)benzamide (PubChem CID 134548576) has the molecular formula C24H29ClF3N3O5S and a molecular weight of 564.03 g/mol. Its IUPAC name is N-[(5-chloro-2-ethylsulfonylphenyl)methyl]-3-[4-(1-hydroxyethylamino)piperidin-1-yl]-5-(trifluoromethoxy)benzamide.
| Compound Name | N-[(5-chloro-2-ethylsulfonylphenyl)methyl]-3-[4-(1-hydroxyethylamino)piperidin-1-yl]-5-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 134548576 |
| Molecular Formula | C24H29ClF3N3O5S |
| Molecular Weight | 564.03 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | N-[(5-chloro-2-ethylsulfonylphenyl)methyl]-3-[4-(1-hydroxyethylamino)piperidin-1-yl]-5-(trifluoromethoxy)benzamide |
| SMILES | CCS(=O)(=O)c1ccc(Cl)cc1CNC(=O)c1cc(OC(F)(F)F)cc(N2CCC(NC(C)O)CC2)c1 |
| InChI | InChI=1S/C24H29ClF3N3O5S/c1-3-37(34,35)22-5-4-18(25)10-17(22)14-29-23(33)16-11-20(13-21(12-16)36-24(26,27)28)31-8-6-19(7-9-31)30-15(2)32/h4-5,10-13,15,19,30,32H,3,6-9,14H2,1-2H3,(H,29,33) |
| InChIKey | NHWMCEDBPFPRCS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.03 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|