C58H38O2S2 — CID 134550597
2-methyl-2'-[4-[(5'-methyl-9,9'-spirobi[fluorene]-2'-yl)sulfinyl]phenyl]sulfinyl-9,9'-spirobi[fluorene] (PubChem CID 134550597) has the molecular formula C58H38O2S2 and a molecular weight of 831.07 g/mol. Its IUPAC name is 2-methyl-2'-[4-[(5'-methyl-9,9'-spirobi[fluorene]-2'-yl)sulfinyl]phenyl]sulfinyl-9,9'-spirobi[fluorene].
| Compound Name | 2-methyl-2'-[4-[(5'-methyl-9,9'-spirobi[fluorene]-2'-yl)sulfinyl]phenyl]sulfinyl-9,9'-spirobi[fluorene] |
|---|---|
| PubChem CID | 134550597 |
| Molecular Formula | C58H38O2S2 |
| Molecular Weight | 831.07 g/mol |
| Exact Mass | 830.23 |
| IUPAC Name | 2-methyl-2'-[4-[(5'-methyl-9,9'-spirobi[fluorene]-2'-yl)sulfinyl]phenyl]sulfinyl-9,9'-spirobi[fluorene] |
| SMILES | Cc1ccc2c(c1)C1(c3ccccc3-2)c2ccccc2-c2ccc(S(=O)c3ccc(S(=O)c4ccc5c(c4)C4(c6ccccc6-c6ccccc64)c4cccc(C)c4-5)cc3)cc21 |
| InChI | InChI=1S/C58H38O2S2/c1-35-22-29-45-43-15-5-9-19-50(43)58(53(45)32-35)51-20-10-6-16-44(51)46-30-27-39(33-54(46)58)61(59)37-23-25-38(26-24-37)62(60)40-28-31-47-55(34-40)57(52-21-11-12-36(2)56(47)52)48-17-7-3-13-41(48)42-14-4-8-18-49(42)57/h3-34H,1-2H3 |
| InChIKey | FBSOALFCTZAJSW-UHFFFAOYSA-N |
| XLogP | 13.32 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.07 |
| LogP ≤ 5 | 13.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |