C37H24O2S2 — CID 59426988
2,2'-bis(benzenesulfinyl)-9,9'-spirobi[fluorene] (PubChem CID 59426988) has the molecular formula C37H24O2S2 and a molecular weight of 564.73 g/mol. Its IUPAC name is 2,2'-bis(benzenesulfinyl)-9,9'-spirobi[fluorene].
| Compound Name | 2,2'-bis(benzenesulfinyl)-9,9'-spirobi[fluorene] |
|---|---|
| PubChem CID | 59426988 |
| Molecular Formula | C37H24O2S2 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.12 |
| IUPAC Name | 2,2'-bis(benzenesulfinyl)-9,9'-spirobi[fluorene] |
| SMILES | O=S(c1ccccc1)c1ccc2c(c1)C1(c3ccccc3-2)c2ccccc2-c2ccc(S(=O)c3ccccc3)cc21 |
| InChI | InChI=1S/C37H24O2S2/c38-40(25-11-3-1-4-12-25)27-19-21-31-29-15-7-9-17-33(29)37(35(31)23-27)34-18-10-8-16-30(34)32-22-20-28(24-36(32)37)41(39)26-13-5-2-6-14-26/h1-24H |
| InChIKey | KQJOHDQQAIRHKH-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |