C36H33N — CID 134551611
N-[4-(9,9-dimethylfluoren-2-yl)phenyl]-2-phenyl-N-propan-2-ylaniline (PubChem CID 134551611) has the molecular formula C36H33N and a molecular weight of 479.67 g/mol. Its IUPAC name is N-[4-(9,9-dimethylfluoren-2-yl)phenyl]-2-phenyl-N-propan-2-ylaniline.
| Compound Name | N-[4-(9,9-dimethylfluoren-2-yl)phenyl]-2-phenyl-N-propan-2-ylaniline |
|---|---|
| PubChem CID | 134551611 |
| Molecular Formula | C36H33N |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | N-[4-(9,9-dimethylfluoren-2-yl)phenyl]-2-phenyl-N-propan-2-ylaniline |
| SMILES | CC(C)N(c1ccc(-c2ccc3c(c2)C(C)(C)c2ccccc2-3)cc1)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C36H33N/c1-25(2)37(35-17-11-9-14-30(35)27-12-6-5-7-13-27)29-21-18-26(19-22-29)28-20-23-32-31-15-8-10-16-33(31)36(3,4)34(32)24-28/h5-25H,1-4H3 |
| InChIKey | ILIKVINDSCNQJX-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |