C30H29N — CID 134509907
9,9-dimethyl-N,7-diphenyl-N-propan-2-ylfluoren-2-amine (PubChem CID 134509907) has the molecular formula C30H29N and a molecular weight of 403.57 g/mol. Its IUPAC name is 9,9-dimethyl-N,7-diphenyl-N-propan-2-ylfluoren-2-amine.
| Compound Name | 9,9-dimethyl-N,7-diphenyl-N-propan-2-ylfluoren-2-amine |
|---|---|
| PubChem CID | 134509907 |
| Molecular Formula | C30H29N |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 9,9-dimethyl-N,7-diphenyl-N-propan-2-ylfluoren-2-amine |
| SMILES | CC(C)N(c1ccccc1)c1ccc2c(c1)C(C)(C)c1cc(-c3ccccc3)ccc1-2 |
| InChI | InChI=1S/C30H29N/c1-21(2)31(24-13-9-6-10-14-24)25-16-18-27-26-17-15-23(22-11-7-5-8-12-22)19-28(26)30(3,4)29(27)20-25/h5-21H,1-4H3 |
| InChIKey | KKPBFPIPHSJXDJ-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |