C16H28O4 — CID 134552096
(1R,2S,3aS,8aR)-6-(hydroxymethyl)-1-(2-hydroxypropan-2-yl)-3a,8a-dimethyl-3,4,7,8-tetrahydro-2H-azulene-1,2-diol (PubChem CID 134552096) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is (1R,2S,3aS,8aR)-6-(hydroxymethyl)-1-(2-hydroxypropan-2-yl)-3a,8a-dimethyl-3,4,7,8-tetrahydro-2H-azulene-1,2-diol.
| Compound Name | (1R,2S,3aS,8aR)-6-(hydroxymethyl)-1-(2-hydroxypropan-2-yl)-3a,8a-dimethyl-3,4,7,8-tetrahydro-2H-azulene-1,2-diol |
|---|---|
| PubChem CID | 134552096 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | (1R,2S,3aS,8aR)-6-(hydroxymethyl)-1-(2-hydroxypropan-2-yl)-3a,8a-dimethyl-3,4,7,8-tetrahydro-2H-azulene-1,2-diol |
| SMILES | CC(C)(O)[C@]1(O)[C@@H](O)C[C@]2(C)CC=C(CO)CC[C@]21C |
| InChI | InChI=1S/C16H28O4/c1-13(2,19)16(20)12(18)9-14(3)7-5-11(10-17)6-8-15(14,16)4/h5,12,17-20H,6-10H2,1-4H3/t12-,14-,15+,16+/m0/s1 |
| InChIKey | QKNGQHCUEVCESI-ARLBYUKCSA-N |
| XLogP | 1.37 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|