C52H33N7 — CID 134552606
6-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]benzo[b]carbazole (PubChem CID 134552606) has the molecular formula C52H33N7 and a molecular weight of 755.89 g/mol. Its IUPAC name is 6-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]benzo[b]carbazole.
| Compound Name | 6-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]benzo[b]carbazole |
|---|---|
| PubChem CID | 134552606 |
| Molecular Formula | C52H33N7 |
| Molecular Weight | 755.89 g/mol |
| Exact Mass | 755.28 |
| IUPAC Name | 6-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]benzo[b]carbazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-n4c5ccccc5c5cc6ccccc6c(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c54)cc3)n2)cc1 |
| InChI | InChI=1S/C52H33N7/c1-5-17-34(18-6-1)47-53-48(35-19-7-2-8-20-35)55-51(54-47)38-29-31-40(32-30-38)59-44-28-16-15-27-42(44)43-33-39-25-13-14-26-41(39)45(46(43)59)52-57-49(36-21-9-3-10-22-36)56-50(58-52)37-23-11-4-12-24-37/h1-33H |
| InChIKey | BVNDTBCKKYAGKR-UHFFFAOYSA-N |
| XLogP | 12.31 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.89 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |