C39H26N4 — CID 171438087
1-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,9-diphenylcarbazole (PubChem CID 171438087) has the molecular formula C39H26N4 and a molecular weight of 550.67 g/mol. Its IUPAC name is 1-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,9-diphenylcarbazole.
| Compound Name | 1-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,9-diphenylcarbazole |
|---|---|
| PubChem CID | 171438087 |
| Molecular Formula | C39H26N4 |
| Molecular Weight | 550.67 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | 1-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,9-diphenylcarbazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3c(-c4ccccc4)ccc4c5ccccc5n(-c5ccccc5)c34)n2)cc1 |
| InChI | InChI=1S/C39H26N4/c1-5-15-27(16-6-1)31-25-26-33-32-23-13-14-24-34(32)43(30-21-11-4-12-22-30)36(33)35(31)39-41-37(28-17-7-2-8-18-28)40-38(42-39)29-19-9-3-10-20-29/h1-26H |
| InChIKey | NDVZFIWEFIHWIG-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.67 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |