C25H24N8O2 — CID 134557540
N-[3-[4-(1-prop-2-enoylpiperidin-3-yl)triazol-1-yl]phenyl]-6-(1H-pyrazol-5-yl)pyridine-2-carboxamide (PubChem CID 134557540) has the molecular formula C25H24N8O2 and a molecular weight of 468.52 g/mol. Its IUPAC name is N-[3-[4-(1-prop-2-enoylpiperidin-3-yl)triazol-1-yl]phenyl]-6-(1H-pyrazol-5-yl)pyridine-2-carboxamide.
| Compound Name | N-[3-[4-(1-prop-2-enoylpiperidin-3-yl)triazol-1-yl]phenyl]-6-(1H-pyrazol-5-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 134557540 |
| Molecular Formula | C25H24N8O2 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | N-[3-[4-(1-prop-2-enoylpiperidin-3-yl)triazol-1-yl]phenyl]-6-(1H-pyrazol-5-yl)pyridine-2-carboxamide |
| SMILES | C=CC(=O)N1CCCC(c2cn(-c3cccc(NC(=O)c4cccc(-c5ccn[nH]5)n4)c3)nn2)C1 |
| InChI | InChI=1S/C25H24N8O2/c1-2-24(34)32-13-5-6-17(15-32)23-16-33(31-30-23)19-8-3-7-18(14-19)27-25(35)22-10-4-9-20(28-22)21-11-12-26-29-21/h2-4,7-12,14,16-17H,1,5-6,13,15H2,(H,26,29)(H,27,35) |
| InChIKey | TWRQFWSQHVLGLZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 121.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|