C25H28N8O2 — CID 174163276
(3S)-N-[4-[amino-[(Z)-2-amino-2-[6-(1H-pyrazol-5-yl)-2-pyridinyl]ethenyl]amino]phenyl]-1-prop-2-enoylpiperidine-3-carboxamide (PubChem CID 174163276) has the molecular formula C25H28N8O2 and a molecular weight of 472.55 g/mol. Its IUPAC name is (3S)-N-[4-[amino-[(Z)-2-amino-2-[6-(1H-pyrazol-5-yl)-2-pyridinyl]ethenyl]amino]phenyl]-1-prop-2-enoylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-[4-[amino-[(Z)-2-amino-2-[6-(1H-pyrazol-5-yl)-2-pyridinyl]ethenyl]amino]phenyl]-1-prop-2-enoylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 174163276 |
| Molecular Formula | C25H28N8O2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | (3S)-N-[4-[amino-[(Z)-2-amino-2-[6-(1H-pyrazol-5-yl)-2-pyridinyl]ethenyl]amino]phenyl]-1-prop-2-enoylpiperidine-3-carboxamide |
| SMILES | C=CC(=O)N1CCC[C@H](C(=O)Nc2ccc(N(N)/C=C(\N)c3cccc(-c4ccn[nH]4)n3)cc2)C1 |
| InChI | InChI=1S/C25H28N8O2/c1-2-24(34)32-14-4-5-17(15-32)25(35)29-18-8-10-19(11-9-18)33(27)16-20(26)21-6-3-7-22(30-21)23-12-13-28-31-23/h2-3,6-13,16-17H,1,4-5,14-15,26-27H2,(H,28,31)(H,29,35)/b20-16-/t17-/m0/s1 |
| InChIKey | XVVUGOBAJHLZNR-IMGOXIFKSA-N |
| XLogP | 2.47 |
| TPSA | 146.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|