C26H22N6O3 — CID 134557649
N-[4-[[3-(2-formylprop-2-enylamino)benzoyl]amino]phenyl]-6-(1H-pyrazol-4-yl)pyridine-2-carboxamide (PubChem CID 134557649) has the molecular formula C26H22N6O3 and a molecular weight of 466.50 g/mol. Its IUPAC name is N-[4-[[3-(2-formylprop-2-enylamino)benzoyl]amino]phenyl]-6-(1H-pyrazol-4-yl)pyridine-2-carboxamide.
| Compound Name | N-[4-[[3-(2-formylprop-2-enylamino)benzoyl]amino]phenyl]-6-(1H-pyrazol-4-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 134557649 |
| Molecular Formula | C26H22N6O3 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | N-[4-[[3-(2-formylprop-2-enylamino)benzoyl]amino]phenyl]-6-(1H-pyrazol-4-yl)pyridine-2-carboxamide |
| SMILES | C=C(C=O)CNc1cccc(C(=O)Nc2ccc(NC(=O)c3cccc(-c4cn[nH]c4)n3)cc2)c1 |
| InChI | InChI=1S/C26H22N6O3/c1-17(16-33)13-27-22-5-2-4-18(12-22)25(34)30-20-8-10-21(11-9-20)31-26(35)24-7-3-6-23(32-24)19-14-28-29-15-19/h2-12,14-16,27H,1,13H2,(H,28,29)(H,30,34)(H,31,35) |
| InChIKey | OJGFBUPUPAJJIX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|