C21H22N8O2 — CID 134422733
N-[2-[2-[2-(methylamino)ethylamino]-2-oxoethyl]indazol-5-yl]-6-(1H-pyrazol-4-yl)pyridine-2-carboxamide (PubChem CID 134422733) has the molecular formula C21H22N8O2 and a molecular weight of 418.46 g/mol. Its IUPAC name is N-[2-[2-[2-(methylamino)ethylamino]-2-oxoethyl]indazol-5-yl]-6-(1H-pyrazol-4-yl)pyridine-2-carboxamide.
| Compound Name | N-[2-[2-[2-(methylamino)ethylamino]-2-oxoethyl]indazol-5-yl]-6-(1H-pyrazol-4-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 134422733 |
| Molecular Formula | C21H22N8O2 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-[2-[2-[2-(methylamino)ethylamino]-2-oxoethyl]indazol-5-yl]-6-(1H-pyrazol-4-yl)pyridine-2-carboxamide |
| SMILES | CNCCNC(=O)Cn1cc2cc(NC(=O)c3cccc(-c4cn[nH]c4)n3)ccc2n1 |
| InChI | InChI=1S/C21H22N8O2/c1-22-7-8-23-20(30)13-29-12-14-9-16(5-6-18(14)28-29)26-21(31)19-4-2-3-17(27-19)15-10-24-25-11-15/h2-6,9-12,22H,7-8,13H2,1H3,(H,23,30)(H,24,25)(H,26,31) |
| InChIKey | HGYPYOZAFUMPGT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|