C23H20F3N7O2 — CID 134422962
N-[2-[2-oxo-2-[2-(pyridin-4-ylamino)ethylamino]ethyl]indazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 134422962) has the molecular formula C23H20F3N7O2 and a molecular weight of 483.45 g/mol. Its IUPAC name is N-[2-[2-oxo-2-[2-(pyridin-4-ylamino)ethylamino]ethyl]indazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-[2-[2-oxo-2-[2-(pyridin-4-ylamino)ethylamino]ethyl]indazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 134422962 |
| Molecular Formula | C23H20F3N7O2 |
| Molecular Weight | 483.45 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | N-[2-[2-oxo-2-[2-(pyridin-4-ylamino)ethylamino]ethyl]indazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | O=C(Cn1cc2cc(NC(=O)c3cccc(C(F)(F)F)n3)ccc2n1)NCCNc1ccncc1 |
| InChI | InChI=1S/C23H20F3N7O2/c24-23(25,26)20-3-1-2-19(31-20)22(35)30-17-4-5-18-15(12-17)13-33(32-18)14-21(34)29-11-10-28-16-6-8-27-9-7-16/h1-9,12-13H,10-11,14H2,(H,27,28)(H,29,34)(H,30,35) |
| InChIKey | CMZYMHMUKYDLGR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|