C26H23N9O3 — CID 134422759
N-[2-[2-(2-benzamidoethylamino)-2-oxoethyl]indazol-5-yl]-6-(1,2,4-triazol-4-yl)pyridine-2-carboxamide (PubChem CID 134422759) has the molecular formula C26H23N9O3 and a molecular weight of 509.53 g/mol. Its IUPAC name is N-[2-[2-(2-benzamidoethylamino)-2-oxoethyl]indazol-5-yl]-6-(1,2,4-triazol-4-yl)pyridine-2-carboxamide.
| Compound Name | N-[2-[2-(2-benzamidoethylamino)-2-oxoethyl]indazol-5-yl]-6-(1,2,4-triazol-4-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 134422759 |
| Molecular Formula | C26H23N9O3 |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | N-[2-[2-(2-benzamidoethylamino)-2-oxoethyl]indazol-5-yl]-6-(1,2,4-triazol-4-yl)pyridine-2-carboxamide |
| SMILES | O=C(Cn1cc2cc(NC(=O)c3cccc(-n4cnnc4)n3)ccc2n1)NCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H23N9O3/c36-24(27-11-12-28-25(37)18-5-2-1-3-6-18)15-35-14-19-13-20(9-10-21(19)33-35)31-26(38)22-7-4-8-23(32-22)34-16-29-30-17-34/h1-10,13-14,16-17H,11-12,15H2,(H,27,36)(H,28,37)(H,31,38) |
| InChIKey | SEQNTRYSOFMPCH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 148.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|